About 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine
5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 3456545) has the molecular formula C14H14N6
and a molecular weight of 266.31 g/mol. Its IUPAC name is 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine |
| PubChem CID | 3456545 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Cc1cc(C)n2nc(N)c(/N=N/c3ccccc3)c2n1 |
| InChI | InChI=1S/C14H14N6/c1-9-8-10(2)20-14(16-9)12(13(15)19-20)18-17-11-6-4-3-5-7-11/h3-8H,1-2H3,(H2,15,19)/b18-17+ |
| InChIKey | XZQIKWYPMKXWAY-ISLYRVAYSA-N |
| XLogP | 3.34 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine (CID 3456545) is 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine is Cc1cc(C)n2nc(N)c(/N=N/c3ccccc3)c2n1.
What is the InChIKey of 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is XZQIKWYPMKXWAY-ISLYRVAYSA-N. The full InChI is InChI=1S/C14H14N6/c1-9-8-10(2)20-14(16-9)12(13(15)19-20)18-17-11-6-4-3-5-7-11/h3-8H,1-2H3,(H2,15,19)/b18-17+.
What are the key properties of 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine?
5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 266.31 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-3-phenyldiazenylpyrazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 3456545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).