C19H18N4O2 — CID 3456648
N'-[[3-methylidene-1-(4-methylphenyl)-5-oxopyrazolidin-4-ylidene]methyl]benzohydrazide (PubChem CID 3456648) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N'-[[3-methylidene-1-(4-methylphenyl)-5-oxopyrazolidin-4-ylidene]methyl]benzohydrazide.
| Compound Name | N'-[[3-methylidene-1-(4-methylphenyl)-5-oxopyrazolidin-4-ylidene]methyl]benzohydrazide |
|---|---|
| PubChem CID | 3456648 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N'-[[3-methylidene-1-(4-methylphenyl)-5-oxopyrazolidin-4-ylidene]methyl]benzohydrazide |
| SMILES | C=c1[nH]n(-c2ccc(C)cc2)c(=O)c1=CNNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O2/c1-13-8-10-16(11-9-13)23-19(25)17(14(2)22-23)12-20-21-18(24)15-6-4-3-5-7-15/h3-12,20,22H,2H2,1H3,(H,21,24) |
| InChIKey | QWJYFFFGBXREOB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|