About 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea
3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea (PubChem CID 3456697) has the molecular formula C19H25N3S
and a molecular weight of 327.50 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea.
Molecular Properties
| Compound Name | 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea |
| PubChem CID | 3456697 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(CCc2ccncc2)C(C)C)c1C |
| InChI | InChI=1S/C19H25N3S/c1-14(2)22(13-10-17-8-11-20-12-9-17)19(23)21-18-7-5-6-15(3)16(18)4/h5-9,11-12,14H,10,13H2,1-4H3,(H,21,23) |
| InChIKey | FNXFDCBKYAVFMF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea?
The IUPAC name of 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea (CID 3456697) is 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea.
What is the SMILES notation for 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea?
The canonical SMILES for 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea is Cc1cccc(NC(=S)N(CCc2ccncc2)C(C)C)c1C.
What is the InChIKey of 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea?
The InChIKey is FNXFDCBKYAVFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3S/c1-14(2)22(13-10-17-8-11-20-12-9-17)19(23)21-18-7-5-6-15(3)16(18)4/h5-9,11-12,14H,10,13H2,1-4H3,(H,21,23).
What are the key properties of 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea?
3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea has a molecular weight of 327.50 g/mol, XLogP of 4.35, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylphenyl)-1-propan-2-yl-1-(2-pyridin-4-ylethyl)thiourea is sourced from PubChem (CID 3456697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).