About 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid
5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 3456761) has the molecular formula C23H25ClFNO4
and a molecular weight of 433.91 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 3456761 |
| Molecular Formula | C23H25ClFNO4 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | CCCCCC1=NOC(C(=O)O)(C(OCc2ccc(F)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H25ClFNO4/c1-2-3-4-5-20-14-23(22(27)28,30-26-20)21(17-8-10-18(24)11-9-17)29-15-16-6-12-19(25)13-7-16/h6-13,21H,2-5,14-15H2,1H3,(H,27,28) |
| InChIKey | CFRZSOVNSNYBIF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid (CID 3456761) is 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid is CCCCCC1=NOC(C(=O)O)(C(OCc2ccc(F)cc2)c2ccc(Cl)cc2)C1.
What is the InChIKey of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is CFRZSOVNSNYBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClFNO4/c1-2-3-4-5-20-14-23(22(27)28,30-26-20)21(17-8-10-18(24)11-9-17)29-15-16-6-12-19(25)13-7-16/h6-13,21H,2-5,14-15H2,1H3,(H,27,28).
What are the key properties of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid?
5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 433.91 g/mol, XLogP of 5.92, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-pentyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 3456761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).