C30H30O6 — CID 3456938
1,1,2,2-tetrakis(4-methoxyphenyl)ethane-1,2-diol (PubChem CID 3456938) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is 1,1,2,2-tetrakis(4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | 1,1,2,2-tetrakis(4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 3456938 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1,1,2,2-tetrakis(4-methoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H30O6/c1-33-25-13-5-21(6-14-25)29(31,22-7-15-26(34-2)16-8-22)30(32,23-9-17-27(35-3)18-10-23)24-11-19-28(36-4)20-12-24/h5-20,31-32H,1-4H3 |
| InChIKey | GJSYWZLTIIFQTD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |