C13H22N6O3 — CID 3456950
4-N-cyclohexyl-2-N-(2-methoxyethyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3456950) has the molecular formula C13H22N6O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(2-methoxyethyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-cyclohexyl-2-N-(2-methoxyethyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3456950 |
| Molecular Formula | C13H22N6O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(2-methoxyethyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | COCCNc1nc(N)c([N+](=O)[O-])c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H22N6O3/c1-22-8-7-15-13-17-11(14)10(19(20)21)12(18-13)16-9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H4,14,15,16,17,18) |
| InChIKey | CNKKPRAAYPZGRJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|