About N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide
N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide (PubChem CID 3456979) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide.
Molecular Properties
| Compound Name | N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide |
| PubChem CID | 3456979 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide |
| SMILES | CC(=O)N(C1=C(N2CCCCCC2)C(=O)c2ccccc2C1=O)C1CCCCC1 |
| InChI | InChI=1S/C24H30N2O3/c1-17(27)26(18-11-5-4-6-12-18)22-21(25-15-9-2-3-10-16-25)23(28)19-13-7-8-14-20(19)24(22)29/h7-8,13-14,18H,2-6,9-12,15-16H2,1H3 |
| InChIKey | GQUZQBBSQVIVNS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide?
The IUPAC name of N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide (CID 3456979) is N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide.
What is the SMILES notation for N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide?
The canonical SMILES for N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide is CC(=O)N(C1=C(N2CCCCCC2)C(=O)c2ccccc2C1=O)C1CCCCC1.
What is the InChIKey of N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide?
The InChIKey is GQUZQBBSQVIVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-17(27)26(18-11-5-4-6-12-18)22-21(25-15-9-2-3-10-16-25)23(28)19-13-7-8-14-20(19)24(22)29/h7-8,13-14,18H,2-6,9-12,15-16H2,1H3.
What are the key properties of N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide?
N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide has a molecular weight of 394.52 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(azepan-1-yl)-1,4-dioxonaphthalen-2-yl]-N-cyclohexylacetamide is sourced from PubChem (CID 3456979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).