About 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile
2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile (PubChem CID 3457115) has the molecular formula C15H16N6O
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile |
| PubChem CID | 3457115 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile |
| SMILES | N#CCc1c(C#N)c(N)nc(N2CCCC(CO)C2)c1C#N |
| InChI | InChI=1S/C15H16N6O/c16-4-3-11-12(6-17)14(19)20-15(13(11)7-18)21-5-1-2-10(8-21)9-22/h10,22H,1-3,5,8-9H2,(H2,19,20) |
| InChIKey | XPMFPHBVDSPPTL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile (CID 3457115) is 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile is N#CCc1c(C#N)c(N)nc(N2CCCC(CO)C2)c1C#N.
What is the InChIKey of 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile?
The InChIKey is XPMFPHBVDSPPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N6O/c16-4-3-11-12(6-17)14(19)20-15(13(11)7-18)21-5-1-2-10(8-21)9-22/h10,22H,1-3,5,8-9H2,(H2,19,20).
What are the key properties of 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile?
2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile has a molecular weight of 296.33 g/mol, XLogP of 0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(cyanomethyl)-6-[3-(hydroxymethyl)piperidin-1-yl]pyridine-3,5-dicarbonitrile is sourced from PubChem (CID 3457115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).