About 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide
3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide (PubChem CID 34571522) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide.
Molecular Properties
| Compound Name | 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide |
| PubChem CID | 34571522 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide |
| SMILES | Cc1ccc(CCC(=O)NNC(=O)Cc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C19H21FN2O2/c1-13-3-6-16(14(2)11-13)7-10-18(23)21-22-19(24)12-15-4-8-17(20)9-5-15/h3-6,8-9,11H,7,10,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | YWGHCLOPJJSXEY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide?
The IUPAC name of 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide (CID 34571522) is 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide.
What is the SMILES notation for 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide?
The canonical SMILES for 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide is Cc1ccc(CCC(=O)NNC(=O)Cc2ccc(F)cc2)c(C)c1.
What is the InChIKey of 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide?
The InChIKey is YWGHCLOPJJSXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN2O2/c1-13-3-6-16(14(2)11-13)7-10-18(23)21-22-19(24)12-15-4-8-17(20)9-5-15/h3-6,8-9,11H,7,10,12H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide?
3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide has a molecular weight of 328.39 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide is sourced from PubChem (CID 34571522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).