C14H28O8S4 — CID 3457689
1-[1,2,2-tris(propylsulfonyl)ethenylsulfonyl]propane (PubChem CID 3457689) has the molecular formula C14H28O8S4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 1-[1,2,2-tris(propylsulfonyl)ethenylsulfonyl]propane.
| Compound Name | 1-[1,2,2-tris(propylsulfonyl)ethenylsulfonyl]propane |
|---|---|
| PubChem CID | 3457689 |
| Molecular Formula | C14H28O8S4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 1-[1,2,2-tris(propylsulfonyl)ethenylsulfonyl]propane |
| SMILES | CCCS(=O)(=O)C(=C(S(=O)(=O)CCC)S(=O)(=O)CCC)S(=O)(=O)CCC |
| InChI | InChI=1S/C14H28O8S4/c1-5-9-23(15,16)13(24(17,18)10-6-2)14(25(19,20)11-7-3)26(21,22)12-8-4/h5-12H2,1-4H3 |
| InChIKey | ZVSOXKQTDURUJJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |