C21H21BrO6 — CID 34579243
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 4-(3-bromophenoxy)butanoate (PubChem CID 34579243) has the molecular formula C21H21BrO6 and a molecular weight of 449.30 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 4-(3-bromophenoxy)butanoate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 34579243 |
| Molecular Formula | C21H21BrO6 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl] 4-(3-bromophenoxy)butanoate |
| SMILES | O=C(CCCOc1cccc(Br)c1)OCC(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C21H21BrO6/c22-16-4-1-5-17(13-16)25-9-2-6-21(24)28-14-18(23)15-7-8-19-20(12-15)27-11-3-10-26-19/h1,4-5,7-8,12-13H,2-3,6,9-11,14H2 |
| InChIKey | RWMRKPVUBZKXOB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|