C22H21N3O3 — CID 3458466
[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 3458466) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 3458466 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)COC(=O)c3cccn3C)ccc21 |
| InChI | InChI=1S/C22H21N3O3/c1-3-25-18-8-5-4-7-16(18)17-13-15(10-11-19(17)25)23-21(26)14-28-22(27)20-9-6-12-24(20)2/h4-13H,3,14H2,1-2H3,(H,23,26) |
| InChIKey | WOCNZEUBVBSMTC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |