C19H23N5O4 — CID 3459076
8-[(2,3-dimethoxyphenyl)methyl-prop-2-enylamino]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 3459076) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 8-[(2,3-dimethoxyphenyl)methyl-prop-2-enylamino]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(2,3-dimethoxyphenyl)methyl-prop-2-enylamino]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 3459076 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 8-[(2,3-dimethoxyphenyl)methyl-prop-2-enylamino]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | C=CCN(Cc1cccc(OC)c1OC)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H23N5O4/c1-6-10-24(11-12-8-7-9-13(27-4)15(12)28-5)18-20-14-16(21-18)22(2)19(26)23(3)17(14)25/h6-9H,1,10-11H2,2-5H3,(H,20,21) |
| InChIKey | CKPWHGXURJCMFS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|