About methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate
methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate (PubChem CID 3459272) has the molecular formula C24H18ClN3O2
and a molecular weight of 415.88 g/mol. Its IUPAC name is methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate |
| PubChem CID | 3459272 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C=C(c3ccc(Cl)cc3)Nc3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C24H18ClN3O2/c1-30-23(29)17-8-6-16(7-9-17)22-14-20(15-10-12-18(25)13-11-15)27-24-26-19-4-2-3-5-21(19)28(22)24/h2-14,22H,1H3,(H,26,27) |
| InChIKey | GVRUGRAJXOGZCD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate?
The IUPAC name of methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate (CID 3459272) is methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate.
What is the SMILES notation for methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate?
The canonical SMILES for methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate is COC(=O)c1ccc(C2C=C(c3ccc(Cl)cc3)Nc3nc4ccccc4n32)cc1.
What is the InChIKey of methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate?
The InChIKey is GVRUGRAJXOGZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClN3O2/c1-30-23(29)17-8-6-16(7-9-17)22-14-20(15-10-12-18(25)13-11-15)27-24-26-19-4-2-3-5-21(19)28(22)24/h2-14,22H,1H3,(H,26,27).
What are the key properties of methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate?
methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate has a molecular weight of 415.88 g/mol, XLogP of 5.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(4-chlorophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazol-4-yl]benzoate is sourced from PubChem (CID 3459272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).