About [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (PubChem CID 3459531) has the molecular formula C20H20ClN3O6S2
and a molecular weight of 497.98 g/mol. Its IUPAC name is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
Molecular Properties
| Compound Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| PubChem CID | 3459531 |
| Molecular Formula | C20H20ClN3O6S2 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)COC(=O)CC2Sc3ccccc3NC2=O)ccc1Cl |
| InChI | InChI=1S/C20H20ClN3O6S2/c1-24(2)32(28,29)17-9-12(7-8-13(17)21)22-18(25)11-30-19(26)10-16-20(27)23-14-5-3-4-6-15(14)31-16/h3-9,16H,10-11H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | ZRWUYGINWOHPKZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The IUPAC name of [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate (CID 3459531) is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate.
What is the SMILES notation for [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The canonical SMILES for [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate is CN(C)S(=O)(=O)c1cc(NC(=O)COC(=O)CC2Sc3ccccc3NC2=O)ccc1Cl.
What is the InChIKey of [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
The InChIKey is ZRWUYGINWOHPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClN3O6S2/c1-24(2)32(28,29)17-9-12(7-8-13(17)21)22-18(25)11-30-19(26)10-16-20(27)23-14-5-3-4-6-15(14)31-16/h3-9,16H,10-11H2,1-2H3,(H,22,25)(H,23,27).
What are the key properties of [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate?
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate has a molecular weight of 497.98 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetate is sourced from PubChem (CID 3459531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).