C11H8N4S — CID 3459572
2-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]propanedinitrile (PubChem CID 3459572) has the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]propanedinitrile.
| Compound Name | 2-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3459572 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylidene]propanedinitrile |
| SMILES | Cc1nc2scc(C)n2c1C=C(C#N)C#N |
| InChI | InChI=1S/C11H8N4S/c1-7-6-16-11-14-8(2)10(15(7)11)3-9(4-12)5-13/h3,6H,1-2H3 |
| InChIKey | WTPPAVZAESUIRK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|