About [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 3460226) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate |
| PubChem CID | 3460226 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | COc1ccc(CNC(=O)COC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-23-17-10-7-16(8-11-17)13-20-18(21)14-24-19(22)12-9-15-5-3-2-4-6-15/h7-8,10-11,15H,2-6,9,12-14H2,1H3,(H,20,21) |
| InChIKey | WOGBENGPKIRREC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate?
The IUPAC name of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate (CID 3460226) is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate.
What is the SMILES notation for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate?
The canonical SMILES for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate is COc1ccc(CNC(=O)COC(=O)CCC2CCCCC2)cc1.
What is the InChIKey of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate?
The InChIKey is WOGBENGPKIRREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO4/c1-23-17-10-7-16(8-11-17)13-20-18(21)14-24-19(22)12-9-15-5-3-2-4-6-15/h7-8,10-11,15H,2-6,9,12-14H2,1H3,(H,20,21).
What are the key properties of [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate?
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate has a molecular weight of 333.43 g/mol, XLogP of 3.22, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl] 3-cyclohexylpropanoate is sourced from PubChem (CID 3460226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).