About 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione
1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione (PubChem CID 34604510) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione.
Molecular Properties
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione |
| PubChem CID | 34604510 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione |
| SMILES | CC(C)(C)c1ccc(C(=O)CN2C(=O)C(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)15-11-9-14(10-12-15)17(24)13-22-18(25)19(26)23(20(22)27)16-7-5-4-6-8-16/h9-12,16H,4-8,13H2,1-3H3 |
| InChIKey | MIEUQCPAFUEBRH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione?
The IUPAC name of 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione (CID 34604510) is 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione.
What is the SMILES notation for 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione?
The canonical SMILES for 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione is CC(C)(C)c1ccc(C(=O)CN2C(=O)C(=O)N(C3CCCCC3)C2=O)cc1.
What is the InChIKey of 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione?
The InChIKey is MIEUQCPAFUEBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O4/c1-21(2,3)15-11-9-14(10-12-15)17(24)13-22-18(25)19(26)23(20(22)27)16-7-5-4-6-8-16/h9-12,16H,4-8,13H2,1-3H3.
What are the key properties of 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione?
1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione has a molecular weight of 370.45 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-tert-butylphenyl)-2-oxoethyl]-3-cyclohexylimidazolidine-2,4,5-trione is sourced from PubChem (CID 34604510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).