3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid

C12H11NO3 — CID 3460796

IUPAC3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid
SMILESO=C(O)CCc1ncc(-c2ccccc2)o1
InChIInChI=1S/C12H11NO3/c14-12(15)7-6-11-13-8-10(16-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,15)
InChIKeyGFVIYHMHRMUSLA-UHFFFAOYSA-N
MW217.22 g/mol
LogP2.36
Rot. Bonds4

About 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid

3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid (PubChem CID 3460796) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid
PubChem CID3460796
Molecular FormulaC12H11NO3
Molecular Weight217.22 g/mol
Exact Mass217.07
IUPAC Name3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid
SMILESO=C(O)CCc1ncc(-c2ccccc2)o1
InChIInChI=1S/C12H11NO3/c14-12(15)7-6-11-13-8-10(16-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,15)
InChIKeyGFVIYHMHRMUSLA-UHFFFAOYSA-N
XLogP2.36
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.22
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid?
The IUPAC name of 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid (CID 3460796) is 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid?
The canonical SMILES for 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid is O=C(O)CCc1ncc(-c2ccccc2)o1.
What is the InChIKey of 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid?
The InChIKey is GFVIYHMHRMUSLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c14-12(15)7-6-11-13-8-10(16-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,14,15).
What are the key properties of 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid?
3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid has a molecular weight of 217.22 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1,3-oxazol-2-yl)propanoic acid is sourced from PubChem (CID 3460796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).