C46H39N3O8 — CID 3461041
5'-(4-hydroxybut-1-ynyl)-6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-1'-(1-phenylethylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-8-carboxylic acid (PubChem CID 3461041) has the molecular formula C46H39N3O8 and a molecular weight of 761.83 g/mol. Its IUPAC name is 5'-(4-hydroxybut-1-ynyl)-6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-1'-(1-phenylethylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-8-carboxylic acid.
| Compound Name | 5'-(4-hydroxybut-1-ynyl)-6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-1'-(1-phenylethylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-8-carboxylic acid |
|---|---|
| PubChem CID | 3461041 |
| Molecular Formula | C46H39N3O8 |
| Molecular Weight | 761.83 g/mol |
| Exact Mass | 761.27 |
| IUPAC Name | 5'-(4-hydroxybut-1-ynyl)-6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-1'-(1-phenylethylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-8-carboxylic acid |
| SMILES | CC(NC(=O)N1C(=O)C2(c3cc(C#CCCO)ccc31)C(C(=O)O)C1C(=O)OC(c3ccccc3)C(c3ccccc3)N1C2c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C46H39N3O8/c1-28(30-14-5-2-6-15-30)47-45(56)48-36-25-20-29(13-11-12-26-50)27-35(36)46(44(48)55)37(42(52)53)39-43(54)57-40(32-18-9-4-10-19-32)38(31-16-7-3-8-17-31)49(39)41(46)33-21-23-34(51)24-22-33/h2-10,14-25,27-28,37-41,50-51H,12,26H2,1H3,(H,47,56)(H,52,53) |
| InChIKey | LRHONUCFUURDEG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.83 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|