C19H20F3N5O2S — CID 3461295
3-[1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-4-(2,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 3461295) has the molecular formula C19H20F3N5O2S and a molecular weight of 439.46 g/mol. Its IUPAC name is 3-[1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-4-(2,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-4-(2,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3461295 |
| Molecular Formula | C19H20F3N5O2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-[1-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]ethyl]-4-(2,4-dimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(C(C)n3nc(C(F)(F)F)cc3C3CC3)n[nH]c2=S)c(OC)c1 |
| InChI | InChI=1S/C19H20F3N5O2S/c1-10(27-14(11-4-5-11)9-16(25-27)19(20,21)22)17-23-24-18(30)26(17)13-7-6-12(28-2)8-15(13)29-3/h6-11H,4-5H2,1-3H3,(H,24,30) |
| InChIKey | RZFONRQNNHHUPH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|