C15H16N6O2S — CID 3461584
4-(2,4-dimethylphenyl)-3-[2-(3-nitropyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 3461584) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-3-[2-(3-nitropyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,4-dimethylphenyl)-3-[2-(3-nitropyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3461584 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-3-[2-(3-nitropyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(CCn3ccc([N+](=O)[O-])n3)n[nH]c2=S)c(C)c1 |
| InChI | InChI=1S/C15H16N6O2S/c1-10-3-4-12(11(2)9-10)20-13(16-17-15(20)24)5-7-19-8-6-14(18-19)21(22)23/h3-4,6,8-9H,5,7H2,1-2H3,(H,17,24) |
| InChIKey | RFBFRGWAMHCGAO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|