C22H19ClN4O8 — CID 3463262
3-(carboxymethyl)-1-(5-chloro-2-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3463262) has the molecular formula C22H19ClN4O8 and a molecular weight of 502.87 g/mol. Its IUPAC name is 3-(carboxymethyl)-1-(5-chloro-2-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(carboxymethyl)-1-(5-chloro-2-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3463262 |
| Molecular Formula | C22H19ClN4O8 |
| Molecular Weight | 502.87 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 3-(carboxymethyl)-1-(5-chloro-2-nitrophenyl)-4,6-dioxo-5-(2-pyridin-2-ylethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)NC(c2cc(Cl)ccc2[N+](=O)[O-])C2C(=O)N(CCc3ccccn3)C(=O)C21 |
| InChI | InChI=1S/C22H19ClN4O8/c23-11-4-5-14(27(34)35)13(9-11)18-16-17(22(25-18,21(32)33)10-15(28)29)20(31)26(19(16)30)8-6-12-3-1-2-7-24-12/h1-5,7,9,16-18,25H,6,8,10H2,(H,28,29)(H,32,33) |
| InChIKey | PBIQHCZNYZFOFL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 180.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.87 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|