C16H15N3O4 — CID 34634227
1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[(1S)-1-phenylethyl]imidazolidine-2,4,5-trione (PubChem CID 34634227) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[(1S)-1-phenylethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[(1S)-1-phenylethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 34634227 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-[(1S)-1-phenylethyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1cc(CN2C(=O)C(=O)N([C@@H](C)c3ccccc3)C2=O)on1 |
| InChI | InChI=1S/C16H15N3O4/c1-10-8-13(23-17-10)9-18-14(20)15(21)19(16(18)22)11(2)12-6-4-3-5-7-12/h3-8,11H,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | SBINBIIFKRWPRA-NSHDSACASA-N |
| XLogP | 2.04 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|