About (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone
(2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone (PubChem CID 3463564) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 3463564 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C15H18N2O3/c1-10-5-3-6-11(2)17(10)15(18)12-9-14(20-16-12)13-7-4-8-19-13/h4,7-11H,3,5-6H2,1-2H3 |
| InChIKey | KJUVSCCGIVDJOO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone (CID 3463564) is (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone is CC1CCCC(C)N1C(=O)c1cc(-c2ccco2)on1.
What is the InChIKey of (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone?
The InChIKey is KJUVSCCGIVDJOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-10-5-3-6-11(2)17(10)15(18)12-9-14(20-16-12)13-7-4-8-19-13/h4,7-11H,3,5-6H2,1-2H3.
What are the key properties of (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone?
(2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone has a molecular weight of 274.32 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylpiperidin-1-yl)-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 3463564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).