About methyl piperidine-2-carboxylate
methyl piperidine-2-carboxylate (PubChem CID 3463753) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is methyl piperidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl piperidine-2-carboxylate |
| PubChem CID | 3463753 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | methyl piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1 |
| InChI | InChI=1S/C7H13NO2/c1-10-7(9)6-4-2-3-5-8-6/h6,8H,2-5H2,1H3 |
| InChIKey | CXQTTWVBUDFUNO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl piperidine-2-carboxylate?
The IUPAC name of methyl piperidine-2-carboxylate (CID 3463753) is methyl piperidine-2-carboxylate.
What is the SMILES notation for methyl piperidine-2-carboxylate?
The canonical SMILES for methyl piperidine-2-carboxylate is COC(=O)C1CCCCN1.
What is the InChIKey of methyl piperidine-2-carboxylate?
The InChIKey is CXQTTWVBUDFUNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-10-7(9)6-4-2-3-5-8-6/h6,8H,2-5H2,1H3.
What are the key properties of methyl piperidine-2-carboxylate?
methyl piperidine-2-carboxylate has a molecular weight of 143.19 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl piperidine-2-carboxylate is sourced from PubChem (CID 3463753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).