About (3-chlorophenyl)methyl pyridine-3-carboxylate
(3-chlorophenyl)methyl pyridine-3-carboxylate (PubChem CID 3463930) has the molecular formula C13H10ClNO2
and a molecular weight of 247.68 g/mol. Its IUPAC name is (3-chlorophenyl)methyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl pyridine-3-carboxylate |
| PubChem CID | 3463930 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (3-chlorophenyl)methyl pyridine-3-carboxylate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1cccnc1 |
| InChI | InChI=1S/C13H10ClNO2/c14-12-5-1-3-10(7-12)9-17-13(16)11-4-2-6-15-8-11/h1-8H,9H2 |
| InChIKey | RZANMGDBQOVMGG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chlorophenyl)methyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl pyridine-3-carboxylate?
The IUPAC name of (3-chlorophenyl)methyl pyridine-3-carboxylate (CID 3463930) is (3-chlorophenyl)methyl pyridine-3-carboxylate.
What is the SMILES notation for (3-chlorophenyl)methyl pyridine-3-carboxylate?
The canonical SMILES for (3-chlorophenyl)methyl pyridine-3-carboxylate is O=C(OCc1cccc(Cl)c1)c1cccnc1.
What is the InChIKey of (3-chlorophenyl)methyl pyridine-3-carboxylate?
The InChIKey is RZANMGDBQOVMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO2/c14-12-5-1-3-10(7-12)9-17-13(16)11-4-2-6-15-8-11/h1-8H,9H2.
What are the key properties of (3-chlorophenyl)methyl pyridine-3-carboxylate?
(3-chlorophenyl)methyl pyridine-3-carboxylate has a molecular weight of 247.68 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl pyridine-3-carboxylate is sourced from PubChem (CID 3463930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).