C12H8F7NO — CID 3464723
1-(2,3-dihydroindol-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 3464723) has the molecular formula C12H8F7NO and a molecular weight of 315.19 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 3464723 |
| Molecular Formula | C12H8F7NO |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(N1CCc2ccccc21)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F7NO/c13-10(14,11(15,16)12(17,18)19)9(21)20-6-5-7-3-1-2-4-8(7)20/h1-4H,5-6H2 |
| InChIKey | AZUBAGCUMALAFX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|