C26H24N4O4S — CID 34659089
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N'-[2-(2-phenylphenoxy)acetyl]pyridine-3-carbohydrazide (PubChem CID 34659089) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N'-[2-(2-phenylphenoxy)acetyl]pyridine-3-carbohydrazide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N'-[2-(2-phenylphenoxy)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 34659089 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N'-[2-(2-phenylphenoxy)acetyl]pyridine-3-carbohydrazide |
| SMILES | Cc1noc(C)c1CSc1ncccc1C(=O)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O4S/c1-17-22(18(2)34-30-17)16-35-26-21(12-8-14-27-26)25(32)29-28-24(31)15-33-23-13-7-6-11-20(23)19-9-4-3-5-10-19/h3-14H,15-16H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | ACIWQCXBAGALTA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|