C14H14N4 — CID 3466575
2-(4,6-dimethylpyrimidin-2-yl)-3H-isoindol-1-imine (PubChem CID 3466575) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-3H-isoindol-1-imine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-3H-isoindol-1-imine |
|---|---|
| PubChem CID | 3466575 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-3H-isoindol-1-imine |
| SMILES | [H]/N=C1\c2ccccc2CN1c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H14N4/c1-9-7-10(2)17-14(16-9)18-8-11-5-3-4-6-12(11)13(18)15/h3-7,15H,8H2,1-2H3/b15-13+ |
| InChIKey | CNIPEVQUYISKFW-FYWRMAATSA-N |
| XLogP | 2.44 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|