C22H20Cl2N4O3S2 — CID 3466680
N-[(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3466680) has the molecular formula C22H20Cl2N4O3S2 and a molecular weight of 523.47 g/mol. Its IUPAC name is N-[(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3466680 |
| Molecular Formula | C22H20Cl2N4O3S2 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | N-[(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NC(=S)Nc1sc2c(c1C(N)=O)CCC(C)C2 |
| InChI | InChI=1S/C22H20Cl2N4O3S2/c1-9-6-7-11-14(8-9)33-21(16(11)19(25)29)27-22(32)26-20(30)15-10(2)31-28-18(15)17-12(23)4-3-5-13(17)24/h3-5,9H,6-8H2,1-2H3,(H2,25,29)(H2,26,27,30,32) |
| InChIKey | LSOSVMXSOIGCSF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|