About Gentamicin
Gentamicin (PubChem CID 3467) has the molecular formula C21H43N5O7
and a molecular weight of 477.60 g/mol. Its IUPAC name is 2-[4,6-diamino-3-[3-amino-6-[1-(methylamino)ethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol.
Molecular Properties
| Compound Name | Gentamicin |
| PubChem CID | 3467 |
| Molecular Formula | C21H43N5O7 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 2-[4,6-diamino-3-[3-amino-6-[1-(methylamino)ethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
| SMILES | CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)NC |
| InChI | InChI=1S/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3 |
| InChIKey | CEAZRRDELHUEMR-UHFFFAOYSA-N |
| XLogP | -4.10 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | 636 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze Gentamicin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Gentamicin?
The IUPAC name of Gentamicin (CID 3467) is 2-[4,6-diamino-3-[3-amino-6-[1-(methylamino)ethyl]oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol.
What is the SMILES notation for Gentamicin?
The canonical SMILES for Gentamicin is CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)NC.
What is the InChIKey of Gentamicin?
The InChIKey is CEAZRRDELHUEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43N5O7/c1-9(25-3)13-6-5-10(22)19(31-13)32-16-11(23)7-12(24)17(14(16)27)33-20-15(28)18(26-4)21(2,29)8-30-20/h9-20,25-29H,5-8,22-24H2,1-4H3.
What are the key properties of Gentamicin?
Gentamicin has a molecular weight of 477.60 g/mol, XLogP of -4.10, 7 rotatable bonds, 8 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for Gentamicin is sourced from PubChem (CID 3467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).