About N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline
N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline (PubChem CID 3468882) has the molecular formula C18H22N2
and a molecular weight of 266.39 g/mol. Its IUPAC name is N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline |
| PubChem CID | 3468882 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline |
| SMILES | Cc1cc(C)c(/N=C/c2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C18H22N2/c1-13-10-14(2)18(15(3)11-13)19-12-16-6-8-17(9-7-16)20(4)5/h6-12H,1-5H3/b19-12+ |
| InChIKey | RTDULXKNAGWBKL-XDHOZWIPSA-N |
| XLogP | 4.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline?
The IUPAC name of N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline (CID 3468882) is N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline.
What is the SMILES notation for N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline?
The canonical SMILES for N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline is Cc1cc(C)c(/N=C/c2ccc(N(C)C)cc2)c(C)c1.
What is the InChIKey of N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline?
The InChIKey is RTDULXKNAGWBKL-XDHOZWIPSA-N. The full InChI is InChI=1S/C18H22N2/c1-13-10-14(2)18(15(3)11-13)19-12-16-6-8-17(9-7-16)20(4)5/h6-12H,1-5H3/b19-12+.
What are the key properties of N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline?
N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline has a molecular weight of 266.39 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-[(2,4,6-trimethylphenyl)iminomethyl]aniline is sourced from PubChem (CID 3468882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).