C22H17N3O4 — CID 3469240
[2-(furan-2-yl)-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone (PubChem CID 3469240) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is [2-(furan-2-yl)-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone.
| Compound Name | [2-(furan-2-yl)-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 3469240 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [2-(furan-2-yl)-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1C(c2ccco2)C([N+](=O)[O-])C2c3ccccc3C=NN12 |
| InChI | InChI=1S/C22H17N3O4/c26-22(14-7-2-1-3-8-14)21-18(17-11-6-12-29-17)20(25(27)28)19-16-10-5-4-9-15(16)13-23-24(19)21/h1-13,18-21H |
| InChIKey | GYTQWQDOZABPNL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|