C14H10F17NO2 — CID 3469487
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(oxolan-2-ylmethyl)nonanamide (PubChem CID 3469487) has the molecular formula C14H10F17NO2 and a molecular weight of 547.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(oxolan-2-ylmethyl)nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(oxolan-2-ylmethyl)nonanamide |
|---|---|
| PubChem CID | 3469487 |
| Molecular Formula | C14H10F17NO2 |
| Molecular Weight | 547.21 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(oxolan-2-ylmethyl)nonanamide |
| SMILES | O=C(NCC1CCCO1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F17NO2/c15-7(16,6(33)32-4-5-2-1-3-34-5)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h5H,1-4H2,(H,32,33) |
| InChIKey | HPTQFNLWBDFFAN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|