About 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one
1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one (PubChem CID 3469571) has the molecular formula C18H17F2NO3
and a molecular weight of 333.33 g/mol. Its IUPAC name is 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one |
| PubChem CID | 3469571 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one |
| SMILES | COc1cccc(C2N(Cc3ccccc3)C(=O)C2(F)F)c1OC |
| InChI | InChI=1S/C18H17F2NO3/c1-23-14-10-6-9-13(15(14)24-2)16-18(19,20)17(22)21(16)11-12-7-4-3-5-8-12/h3-10,16H,11H2,1-2H3 |
| InChIKey | LSZHPLVOHWXNHM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one?
The IUPAC name of 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one (CID 3469571) is 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one.
What is the SMILES notation for 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one?
The canonical SMILES for 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one is COc1cccc(C2N(Cc3ccccc3)C(=O)C2(F)F)c1OC.
What is the InChIKey of 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one?
The InChIKey is LSZHPLVOHWXNHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2NO3/c1-23-14-10-6-9-13(15(14)24-2)16-18(19,20)17(22)21(16)11-12-7-4-3-5-8-12/h3-10,16H,11H2,1-2H3.
What are the key properties of 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one?
1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one has a molecular weight of 333.33 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(2,3-dimethoxyphenyl)-3,3-difluoroazetidin-2-one is sourced from PubChem (CID 3469571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).