C17H17NOS — CID 3470012
3-benzyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 3470012) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-benzyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3470012 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-benzyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-13-7-9-15(10-8-13)17-18(16(19)12-20-17)11-14-5-3-2-4-6-14/h2-10,17H,11-12H2,1H3 |
| InChIKey | KCPNWAHYGWYZLC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |