C20H22ClN5 — CID 34700412
2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-amine (PubChem CID 34700412) has the molecular formula C20H22ClN5 and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-amine.
| Compound Name | 2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 34700412 |
| Molecular Formula | C20H22ClN5 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-amine |
| SMILES | Nc1nc(CN2CCN(Cc3ccc(Cl)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C20H22ClN5/c21-16-7-5-15(6-8-16)13-25-9-11-26(12-10-25)14-19-23-18-4-2-1-3-17(18)20(22)24-19/h1-8H,9-14H2,(H2,22,23,24) |
| InChIKey | PCFWLNBDTBIBAL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |