C14H28N6 — CID 3470184
3-[4-(6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexan-3-yl)butyl]-6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexane (PubChem CID 3470184) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-[4-(6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexan-3-yl)butyl]-6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexane.
| Compound Name | 3-[4-(6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexan-3-yl)butyl]-6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 3470184 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-[4-(6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexan-3-yl)butyl]-6,6-dimethyl-1,3,5-triazabicyclo[3.1.0]hexane |
| SMILES | CC1(C)N2CN(CCCCN3CN4N(C3)C4(C)C)CN21 |
| InChI | InChI=1S/C14H28N6/c1-13(2)17-9-15(10-18(13)17)7-5-6-8-16-11-19-14(3,4)20(19)12-16/h5-12H2,1-4H3 |
| InChIKey | DGFHXLNTLIEWTK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 18.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|