C19H19NS2 — CID 3470648
3-butyl-4,5-diphenyl-1,3-thiazole-2-thione (PubChem CID 3470648) has the molecular formula C19H19NS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione.
| Compound Name | 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 3470648 |
| Molecular Formula | C19H19NS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione |
| SMILES | CCCCn1c(-c2ccccc2)c(-c2ccccc2)sc1=S |
| InChI | InChI=1S/C19H19NS2/c1-2-3-14-20-17(15-10-6-4-7-11-15)18(22-19(20)21)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | XPTDJBBLSRWHSE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|