About 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione
3-butyl-4,5-diphenyl-1,3-thiazole-2-thione (PubChem CID 3470648) has the molecular formula C19H19NS2
and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione |
| PubChem CID | 3470648 |
| Molecular Formula | C19H19NS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione |
| SMILES | CCCCn1c(-c2ccccc2)c(-c2ccccc2)sc1=S |
| InChI | InChI=1S/C19H19NS2/c1-2-3-14-20-17(15-10-6-4-7-11-15)18(22-19(20)21)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | XPTDJBBLSRWHSE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione?
The IUPAC name of 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione (CID 3470648) is 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione.
What is the SMILES notation for 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione?
The canonical SMILES for 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione is CCCCn1c(-c2ccccc2)c(-c2ccccc2)sc1=S.
What is the InChIKey of 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione?
The InChIKey is XPTDJBBLSRWHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NS2/c1-2-3-14-20-17(15-10-6-4-7-11-15)18(22-19(20)21)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3.
What are the key properties of 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione?
3-butyl-4,5-diphenyl-1,3-thiazole-2-thione has a molecular weight of 325.50 g/mol, XLogP of 6.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-4,5-diphenyl-1,3-thiazole-2-thione is sourced from PubChem (CID 3470648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).