C17H17BrFN3O — CID 3470743
2-(4-bromoanilino)-N-[(2-fluorophenyl)methylideneamino]butanamide (PubChem CID 3470743) has the molecular formula C17H17BrFN3O and a molecular weight of 378.25 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(2-fluorophenyl)methylideneamino]butanamide.
| Compound Name | 2-(4-bromoanilino)-N-[(2-fluorophenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 3470743 |
| Molecular Formula | C17H17BrFN3O |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(2-fluorophenyl)methylideneamino]butanamide |
| SMILES | CCC(Nc1ccc(Br)cc1)C(=O)NN=Cc1ccccc1F |
| InChI | InChI=1S/C17H17BrFN3O/c1-2-16(21-14-9-7-13(18)8-10-14)17(23)22-20-11-12-5-3-4-6-15(12)19/h3-11,16,21H,2H2,1H3,(H,22,23) |
| InChIKey | QEPOUPWAWMBJOK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|