C16H28F4N2O2 — CID 3470893
2,2,3,3-tetrafluoro-N,N,N',N'-tetra(propan-2-yl)butanediamide (PubChem CID 3470893) has the molecular formula C16H28F4N2O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N,N',N'-tetra(propan-2-yl)butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N,N',N'-tetra(propan-2-yl)butanediamide |
|---|---|
| PubChem CID | 3470893 |
| Molecular Formula | C16H28F4N2O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N,N',N'-tetra(propan-2-yl)butanediamide |
| SMILES | CC(C)N(C(=O)C(F)(F)C(F)(F)C(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H28F4N2O2/c1-9(2)21(10(3)4)13(23)15(17,18)16(19,20)14(24)22(11(5)6)12(7)8/h9-12H,1-8H3 |
| InChIKey | DUGWRQQBECMKJG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|