About 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one
4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one (PubChem CID 3471221) has the molecular formula C14H14N4O6
and a molecular weight of 334.29 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one.
Molecular Properties
| Compound Name | 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one |
| PubChem CID | 3471221 |
| Molecular Formula | C14H14N4O6 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one |
| SMILES | CN1CCN(c2c([N+](=O)[O-])c(=O)oc3ccc([N+](=O)[O-])cc23)CC1 |
| InChI | InChI=1S/C14H14N4O6/c1-15-4-6-16(7-5-15)12-10-8-9(17(20)21)2-3-11(10)24-14(19)13(12)18(22)23/h2-3,8H,4-7H2,1H3 |
| InChIKey | LZVAAFLJHXHOLE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 122.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one?
The IUPAC name of 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one (CID 3471221) is 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one.
What is the SMILES notation for 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one?
The canonical SMILES for 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one is CN1CCN(c2c([N+](=O)[O-])c(=O)oc3ccc([N+](=O)[O-])cc23)CC1.
What is the InChIKey of 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one?
The InChIKey is LZVAAFLJHXHOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O6/c1-15-4-6-16(7-5-15)12-10-8-9(17(20)21)2-3-11(10)24-14(19)13(12)18(22)23/h2-3,8H,4-7H2,1H3.
What are the key properties of 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one?
4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one has a molecular weight of 334.29 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpiperazin-1-yl)-3,6-dinitrochromen-2-one is sourced from PubChem (CID 3471221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).