C22H22O4 — CID 3471455
dimethyl hexacyclo[9.3.2.25,8.02,14.03,10.04,9]octadeca-6,12,15,17-tetraene-6,7-dicarboxylate (PubChem CID 3471455) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is dimethyl hexacyclo[9.3.2.25,8.02,14.03,10.04,9]octadeca-6,12,15,17-tetraene-6,7-dicarboxylate.
| Compound Name | dimethyl hexacyclo[9.3.2.25,8.02,14.03,10.04,9]octadeca-6,12,15,17-tetraene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 3471455 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | dimethyl hexacyclo[9.3.2.25,8.02,14.03,10.04,9]octadeca-6,12,15,17-tetraene-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C=CC1C1C3C4C=CC5C(C=C4)C5C3C21 |
| InChI | InChI=1S/C22H22O4/c1-25-21(23)18-12-7-8-13(19(18)22(24)26-2)17-16(12)14-9-3-5-10-11(6-4-9)15(10)20(14)17/h3-17,20H,1-2H3 |
| InChIKey | XQNVACDZHJISQC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|