C22H30N2O4 — CID 3472067
5-butyl-1-(2,5-dimethylphenyl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3472067) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 5-butyl-1-(2,5-dimethylphenyl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-butyl-1-(2,5-dimethylphenyl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3472067 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 5-butyl-1-(2,5-dimethylphenyl)-4,6-dioxo-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cc(C)ccc3C)NC(C(=O)O)(C(C)C)C2C1=O |
| InChI | InChI=1S/C22H30N2O4/c1-6-7-10-24-19(25)16-17(20(24)26)22(12(2)3,21(27)28)23-18(16)15-11-13(4)8-9-14(15)5/h8-9,11-12,16-18,23H,6-7,10H2,1-5H3,(H,27,28) |
| InChIKey | KJBZPCXXFSNITA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|