About N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide
N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide (PubChem CID 3472571) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide.
Molecular Properties
| Compound Name | N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide |
| PubChem CID | 3472571 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide |
| SMILES | CCN1C(=O)CC(NNC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C13H15N3O3/c1-2-16-11(17)8-10(13(16)19)14-15-12(18)9-6-4-3-5-7-9/h3-7,10,14H,2,8H2,1H3,(H,15,18) |
| InChIKey | MSZZSVXOFKBDAJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide?
The IUPAC name of N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide (CID 3472571) is N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide.
What is the SMILES notation for N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide?
The canonical SMILES for N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide is CCN1C(=O)CC(NNC(=O)c2ccccc2)C1=O.
What is the InChIKey of N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide?
The InChIKey is MSZZSVXOFKBDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-2-16-11(17)8-10(13(16)19)14-15-12(18)9-6-4-3-5-7-9/h3-7,10,14H,2,8H2,1H3,(H,15,18).
What are the key properties of N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide?
N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide has a molecular weight of 261.28 g/mol, XLogP of 0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-ethyl-2,5-dioxopyrrolidin-3-yl)benzohydrazide is sourced from PubChem (CID 3472571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).