C15H18N2O3S2 — CID 34734892
N,3-dimethyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 34734892) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N,3-dimethyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | N,3-dimethyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 34734892 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N,3-dimethyl-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N(C)[C@H](C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-10-8-9-21-14(10)15(18)17(3)11(2)12-4-6-13(7-5-12)22(16,19)20/h4-9,11H,1-3H3,(H2,16,19,20)/t11-/m1/s1 |
| InChIKey | DZHQFADJSIPAMM-LLVKDONJSA-N |
| XLogP | 2.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |