C27H23N3O2S2 — CID 3473896
5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 3473896) has the molecular formula C27H23N3O2S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3473896 |
| Molecular Formula | C27H23N3O2S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2-phenylphenyl)imino-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(=C2Sc3ccc(OC)cc3N2C)S/C1=N\c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H23N3O2S2/c1-4-16-30-25(31)24(26-29(2)22-17-19(32-3)14-15-23(22)33-26)34-27(30)28-21-13-9-8-12-20(21)18-10-6-5-7-11-18/h4-15,17H,1,16H2,2-3H3/b26-24?,28-27- |
| InChIKey | GSIKJADURZBFQU-OSXSRTQZSA-N |
| XLogP | 6.52 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|