C8H11BrN2O2 — CID 3474051
1-(2-bromoethyl)-3,6-dimethylpyrimidine-2,4-dione (PubChem CID 3474051) has the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-(2-bromoethyl)-3,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3474051 |
| Molecular Formula | C8H11BrN2O2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 1-(2-bromoethyl)-3,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCBr |
| InChI | InChI=1S/C8H11BrN2O2/c1-6-5-7(12)10(2)8(13)11(6)4-3-9/h5H,3-4H2,1-2H3 |
| InChIKey | RVDWHTNPQATQTO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|