C10H8Cl2N6O — CID 3474173
4-amino-N'-[(2,6-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 3474173) has the molecular formula C10H8Cl2N6O and a molecular weight of 299.12 g/mol. Its IUPAC name is 4-amino-N'-[(2,6-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N'-[(2,6-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 3474173 |
| Molecular Formula | C10H8Cl2N6O |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-amino-N'-[(2,6-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NC(=NN=Cc1c(Cl)cccc1Cl)c1nonc1N |
| InChI | InChI=1S/C10H8Cl2N6O/c11-6-2-1-3-7(12)5(6)4-15-16-9(13)8-10(14)18-19-17-8/h1-4H,(H2,13,16)(H2,14,18) |
| InChIKey | FSXONGLVCTVNHG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|